METHYL 5-BROMOPYRIDINE-3-CARBOXYLATE
Methyl 5-bromonicotinate
CAS: 29681-44-5
Molecular Formula: C7H6BrNO2
METHYL 5-BROMOPYRIDINE-3-CARBOXYLATE - Names and Identifiers
| Name | Methyl 5-bromonicotinate |
| Synonyms | METHYL 5-BROMONICOTINATE Methyl 5-bromonicotinate 5-Bromonictinic acid ethyl ester 5-Bromonicotinic Acid Methyl Ester 5-BROMO NICOTINIC ACID METHYL ESTER 5-Bromo nicotinic acid methyl ester Methyl-5-bromo-3-pyridincarboxylate Methyl 5-bromopyridine-3-carboxylate METHYL 5-BROMOPYRIDINE-3-CARBOXYLATE METHYL 3-BROMO-5-PYRIDINECARBOXYLATE 5-Bromopyridine-3-carboxylic acid methyl ester 5-BROMO-3-PYRIDINECARBOXYLIC ACID METHYL ESTER 5-BROMOPYRIDINE-3-CARBOXYLIC ACID METHYL ESTER |
| CAS | 29681-44-5 |
| EINECS | 627-974-5 |
| InChI | InChI=1/C7H6BrNO2/c1-11-7(10)5-2-6(8)4-9-3-5/h2-4H,1H3 |
| InChIKey | AAJZXPWBILCHAW-UHFFFAOYSA-N |
METHYL 5-BROMOPYRIDINE-3-CARBOXYLATE - Physico-chemical Properties
| Molecular Formula | C7H6BrNO2 |
| Molar Mass | 216.03 |
| Density | 1.579±0.06 g/cm3(Predicted) |
| Melting Point | 96-100°C |
| Boling Point | 241.7±20.0 °C(Predicted) |
| Flash Point | 100°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.0354mmHg at 25°C |
| Appearance | White powder |
| pKa | 0.84±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.553 |
| MDL | MFCD00173668 |
METHYL 5-BROMOPYRIDINE-3-CARBOXYLATE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |
METHYL 5-BROMOPYRIDINE-3-CARBOXYLATE - Introduction
Methyl 5-bromonicotinate(Methyl 5-bromonicotinate) is an organic compound with the chemical formula C7H6BrNO2. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: Methyl 5-bromonicotinate is a colorless to pale yellow liquid.
2. Solubility: It is easily soluble in organic solvents such as ethanol, dichloromethane and ether.
3. Melting point and boiling point: melting point is -30 ° C, boiling point is 221 ° C.
Use:
1. Methyl 5-bromonicotinate is usually used as an important intermediate in organic synthesis.
2. It can be used to prepare other compounds, such as drugs and pesticides.
Method:
The preparation method of Methyl 5-bromonicotinate is generally divided into two steps:
1. First, nicotinic acid and sodium nitrite are reacted to obtain nicotinic acid nitrite.
2. Then, Methyl 5-bromonicotinate is obtained by reacting nicotinic acid nitrite with carbon tetrachloride and bromine.
Safety Information:
1. Methyl 5-bromonicotinate should be stored in a sealed container, away from heat and fire sources.
2. When using, please wear appropriate personal protective equipment, such as chemical gloves and goggles.
3. Avoid contact with skin and eyes, such as accidental contact, please rinse immediately with plenty of water.
4. Avoid inhaling aerosols or vapors during operation and ensure good ventilation.
5. In case of accidental ingestion or inhalation, seek medical attention immediately and show the relevant materials and labels to the doctor.
Nature:
1. Appearance: Methyl 5-bromonicotinate is a colorless to pale yellow liquid.
2. Solubility: It is easily soluble in organic solvents such as ethanol, dichloromethane and ether.
3. Melting point and boiling point: melting point is -30 ° C, boiling point is 221 ° C.
Use:
1. Methyl 5-bromonicotinate is usually used as an important intermediate in organic synthesis.
2. It can be used to prepare other compounds, such as drugs and pesticides.
Method:
The preparation method of Methyl 5-bromonicotinate is generally divided into two steps:
1. First, nicotinic acid and sodium nitrite are reacted to obtain nicotinic acid nitrite.
2. Then, Methyl 5-bromonicotinate is obtained by reacting nicotinic acid nitrite with carbon tetrachloride and bromine.
Safety Information:
1. Methyl 5-bromonicotinate should be stored in a sealed container, away from heat and fire sources.
2. When using, please wear appropriate personal protective equipment, such as chemical gloves and goggles.
3. Avoid contact with skin and eyes, such as accidental contact, please rinse immediately with plenty of water.
4. Avoid inhaling aerosols or vapors during operation and ensure good ventilation.
5. In case of accidental ingestion or inhalation, seek medical attention immediately and show the relevant materials and labels to the doctor.
Last Update：2024-04-09 21:01:54
Supplier List
Product Name: Methyl 5-Bromonicotinate Visit Supplier Webpage Request for quotation
CAS: 29681-44-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 29681-44-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Methyl 5-Bromonicotinate Visit Supplier Webpage Request for quotation
CAS: 29681-44-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 29681-44-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History